C9H16F6N+ — CID 98041551
triethyl(1,1,1,3,3,3-hexafluoropropan-2-yl)azanium (PubChem CID 98041551) has the molecular formula C9H16F6N+ and a molecular weight of 252.22 g/mol. Its IUPAC name is triethyl(1,1,1,3,3,3-hexafluoropropan-2-yl)azanium.
| Compound Name | triethyl(1,1,1,3,3,3-hexafluoropropan-2-yl)azanium |
|---|---|
| PubChem CID | 98041551 |
| Molecular Formula | C9H16F6N+ |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | triethyl(1,1,1,3,3,3-hexafluoropropan-2-yl)azanium |
| SMILES | CC[N+](CC)(CC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H16F6N/c1-4-16(5-2,6-3)7(8(10,11)12)9(13,14)15/h7H,4-6H2,1-3H3/q+1 |
| InChIKey | YKEXSMWWMWNRHJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|