C10H18NO8- — CID 98042571
(2R,3S,4R,5R)-6-[2-(dimethylamino)acetyl]oxy-2,3,4,5-tetrahydroxyhexanoate (PubChem CID 98042571) has the molecular formula C10H18NO8- and a molecular weight of 280.25 g/mol. Its IUPAC name is (2R,3S,4R,5R)-6-[2-(dimethylamino)acetyl]oxy-2,3,4,5-tetrahydroxyhexanoate.
| Compound Name | (2R,3S,4R,5R)-6-[2-(dimethylamino)acetyl]oxy-2,3,4,5-tetrahydroxyhexanoate |
|---|---|
| PubChem CID | 98042571 |
| Molecular Formula | C10H18NO8- |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2R,3S,4R,5R)-6-[2-(dimethylamino)acetyl]oxy-2,3,4,5-tetrahydroxyhexanoate |
| SMILES | CN(C)CC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C10H19NO8/c1-11(2)3-6(13)19-4-5(12)7(14)8(15)9(16)10(17)18/h5,7-9,12,14-16H,3-4H2,1-2H3,(H,17,18)/p-1/t5-,7-,8+,9-/m1/s1 |
| InChIKey | ZQTHOIGMSJMBLM-BUJSFMDZSA-M |
| XLogP | -4.72 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |