C7H10O2S — CID 98056298
(2R,4S)-2-acetyl-4-methylthiolan-3-one (PubChem CID 98056298) has the molecular formula C7H10O2S and a molecular weight of 158.22 g/mol. Its IUPAC name is (2R,4S)-2-acetyl-4-methylthiolan-3-one.
| Compound Name | (2R,4S)-2-acetyl-4-methylthiolan-3-one |
|---|---|
| PubChem CID | 98056298 |
| Molecular Formula | C7H10O2S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | (2R,4S)-2-acetyl-4-methylthiolan-3-one |
| SMILES | CC(=O)[C@H]1SC[C@@H](C)C1=O |
| InChI | InChI=1S/C7H10O2S/c1-4-3-10-7(5(2)8)6(4)9/h4,7H,3H2,1-2H3/t4-,7-/m1/s1 |
| InChIKey | DIDRMTPJWQJALM-CLZZGJSISA-N |
| XLogP | 0.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|