C6H13NOS — CID 54492728
ethane;4-methyl-1,2-thiazolidin-3-one (PubChem CID 54492728) has the molecular formula C6H13NOS and a molecular weight of 147.24 g/mol. Its IUPAC name is ethane;4-methyl-1,2-thiazolidin-3-one.
| Compound Name | ethane;4-methyl-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 54492728 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | ethane;4-methyl-1,2-thiazolidin-3-one |
| SMILES | CC.CC1CSNC1=O |
| InChI | InChI=1S/C4H7NOS.C2H6/c1-3-2-7-5-4(3)6;1-2/h3H,2H2,1H3,(H,5,6);1-2H3 |
| InChIKey | XWWUYUQATLTRGM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|