C7H15NO2 — CID 142177654
ethane;5-methyl-1,3-oxazinan-4-one (PubChem CID 142177654) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is ethane;5-methyl-1,3-oxazinan-4-one.
| Compound Name | ethane;5-methyl-1,3-oxazinan-4-one |
|---|---|
| PubChem CID | 142177654 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | ethane;5-methyl-1,3-oxazinan-4-one |
| SMILES | CC.CC1COCNC1=O |
| InChI | InChI=1S/C5H9NO2.C2H6/c1-4-2-8-3-6-5(4)7;1-2/h4H,2-3H2,1H3,(H,6,7);1-2H3 |
| InChIKey | RSPDIORGDQQMHW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |