C28H26FN3O5S — CID 98062633
ethyl 4-[[(6S)-2-(2-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 98062633) has the molecular formula C28H26FN3O5S and a molecular weight of 535.60 g/mol. Its IUPAC name is ethyl 4-[[(6S)-2-(2-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(6S)-2-(2-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 98062633 |
| Molecular Formula | C28H26FN3O5S |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | ethyl 4-[[(6S)-2-(2-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H]2CC(=O)N(Cc3ccc(OC)cc3)/C(=N/c3ccccc3F)S2)cc1 |
| InChI | InChI=1S/C28H26FN3O5S/c1-3-37-27(35)19-10-12-20(13-11-19)30-26(34)24-16-25(33)32(17-18-8-14-21(36-2)15-9-18)28(38-24)31-23-7-5-4-6-22(23)29/h4-15,24H,3,16-17H2,1-2H3,(H,30,34)/b31-28-/t24-/m0/s1 |
| InChIKey | GVRXIVOXIDOSLN-UCSRTCPSSA-N |
| XLogP | 5.17 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|