C22H18FN5O3 — CID 98075114
5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-(4-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 98075114) has the molecular formula C22H18FN5O3 and a molecular weight of 419.42 g/mol. Its IUPAC name is 5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-(4-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-(4-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 98075114 |
| Molecular Formula | C22H18FN5O3 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-(4-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | Cc1cc(C(=O)N2Cc3nc4cc(-c5ccc(F)cc5)[nH]n4c(=O)c3C2)c(=O)[nH]c1C |
| InChI | InChI=1S/C22H18FN5O3/c1-11-7-15(20(29)24-12(11)2)21(30)27-9-16-18(10-27)25-19-8-17(26-28(19)22(16)31)13-3-5-14(23)6-4-13/h3-8,26H,9-10H2,1-2H3,(H,24,29) |
| InChIKey | BLSMRQHLRNLYGC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |