C15H17N5O — CID 98078208
2-imidazol-1-yl-1-[(1S,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone (PubChem CID 98078208) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-imidazol-1-yl-1-[(1S,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone.
| Compound Name | 2-imidazol-1-yl-1-[(1S,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
|---|---|
| PubChem CID | 98078208 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-imidazol-1-yl-1-[(1S,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
| SMILES | Cc1ncc2c(n1)C[C@@H]1CC[C@@H]2N1C(=O)Cn1ccnc1 |
| InChI | InChI=1S/C15H17N5O/c1-10-17-7-12-13(18-10)6-11-2-3-14(12)20(11)15(21)8-19-5-4-16-9-19/h4-5,7,9,11,14H,2-3,6,8H2,1H3/t11-,14-/m0/s1 |
| InChIKey | OYBZPAYDWKEGFM-FZMZJTMJSA-N |
| XLogP | 1.27 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |