C20H25N5O2S — CID 95794802
1-[(1S,9R)-5-[(3S)-3-hydroxypiperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone (PubChem CID 95794802) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-[(1S,9R)-5-[(3S)-3-hydroxypiperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-[(1S,9R)-5-[(3S)-3-hydroxypiperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 95794802 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-[(1S,9R)-5-[(3S)-3-hydroxypiperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
| SMILES | Cc1nc(CC(=O)N2[C@@H]3CC[C@H]2c2cnc(N4CCC[C@H](O)C4)nc2C3)cs1 |
| InChI | InChI=1S/C20H25N5O2S/c1-12-22-13(11-28-12)7-19(27)25-14-4-5-18(25)16-9-21-20(23-17(16)8-14)24-6-2-3-15(26)10-24/h9,11,14-15,18,26H,2-8,10H2,1H3/t14-,15+,18+/m1/s1 |
| InChIKey | RCXNBOIZDJIZJX-VKJFTORMSA-N |
| XLogP | 2.03 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |