C21H28N6O — CID 125037403
(3R)-1-[(1S,9S)-12-[(1-ethenyl-3-methylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol (PubChem CID 125037403) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is (3R)-1-[(1S,9S)-12-[(1-ethenyl-3-methylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol.
| Compound Name | (3R)-1-[(1S,9S)-12-[(1-ethenyl-3-methylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 125037403 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (3R)-1-[(1S,9S)-12-[(1-ethenyl-3-methylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol |
| SMILES | C=Cn1cc(CN2[C@H]3CC[C@H]2c2cnc(N4CCC[C@@H](O)C4)nc2C3)c(C)n1 |
| InChI | InChI=1S/C21H28N6O/c1-3-26-11-15(14(2)24-26)12-27-16-6-7-20(27)18-10-22-21(23-19(18)9-16)25-8-4-5-17(28)13-25/h3,10-11,16-17,20,28H,1,4-9,12-13H2,2H3/t16-,17+,20-/m0/s1 |
| InChIKey | XZUBKZHTYSNSIK-QKLQHJQFSA-N |
| XLogP | 2.30 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |