C19H26N6O3S — CID 125003028
(3R)-1-[(1S,9S)-12-(1-ethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol (PubChem CID 125003028) has the molecular formula C19H26N6O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is (3R)-1-[(1S,9S)-12-(1-ethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol.
| Compound Name | (3R)-1-[(1S,9S)-12-(1-ethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 125003028 |
| Molecular Formula | C19H26N6O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (3R)-1-[(1S,9S)-12-(1-ethylpyrazol-4-yl)sulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol |
| SMILES | CCn1cc(S(=O)(=O)N2[C@H]3CC[C@H]2c2cnc(N4CCC[C@@H](O)C4)nc2C3)cn1 |
| InChI | InChI=1S/C19H26N6O3S/c1-2-24-12-15(9-21-24)29(27,28)25-13-5-6-18(25)16-10-20-19(22-17(16)8-13)23-7-3-4-14(26)11-23/h9-10,12-14,18,26H,2-8,11H2,1H3/t13-,14+,18-/m0/s1 |
| InChIKey | SONQTMFIPXKSOX-IYOUNJFTSA-N |
| XLogP | 1.10 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |