C15H23NO3 — CID 98083512
(1R,3R,5S,7R)-3-acetamido-5-ethyladamantane-1-carboxylic acid (PubChem CID 98083512) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (1R,3R,5S,7R)-3-acetamido-5-ethyladamantane-1-carboxylic acid.
| Compound Name | (1R,3R,5S,7R)-3-acetamido-5-ethyladamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 98083512 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (1R,3R,5S,7R)-3-acetamido-5-ethyladamantane-1-carboxylic acid |
| SMILES | CC[C@@]12C[C@H]3C[C@@](NC(C)=O)(C1)C[C@@](C(=O)O)(C3)C2 |
| InChI | InChI=1S/C15H23NO3/c1-3-13-4-11-5-14(7-13,12(18)19)9-15(6-11,8-13)16-10(2)17/h11H,3-9H2,1-2H3,(H,16,17)(H,18,19)/t11-,13+,14-,15-/m1/s1 |
| InChIKey | HPMOYMFFMYKWGN-FAAHXZRKSA-N |
| XLogP | 2.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |