C26H27N3O6 — CID 98085158
methyl 2-[(1S,2R,6R,7S)-7-(4-methoxyphenyl)-4-(4-methylphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate (PubChem CID 98085158) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is methyl 2-[(1S,2R,6R,7S)-7-(4-methoxyphenyl)-4-(4-methylphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate.
| Compound Name | methyl 2-[(1S,2R,6R,7S)-7-(4-methoxyphenyl)-4-(4-methylphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
|---|---|
| PubChem CID | 98085158 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | methyl 2-[(1S,2R,6R,7S)-7-(4-methoxyphenyl)-4-(4-methylphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
| SMILES | COC(=O)C[C@]12C(=O)NCCN1[C@H](c1ccc(OC)cc1)[C@@H]1C(=O)N(c3ccc(C)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H27N3O6/c1-15-4-8-17(9-5-15)29-23(31)20-21(24(29)32)26(14-19(30)35-3)25(33)27-12-13-28(26)22(20)16-6-10-18(34-2)11-7-16/h4-11,20-22H,12-14H2,1-3H3,(H,27,33)/t20-,21+,22-,26+/m1/s1 |
| InChIKey | JHUFGLRYBFTRHU-SRCYTUNASA-N |
| XLogP | 1.60 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|