C26H25N3O6 — CID 97182726
methyl 2-[(1S,2R,6R,7R)-4-(4-acetylphenyl)-3,5,12-trioxo-7-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate (PubChem CID 97182726) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is methyl 2-[(1S,2R,6R,7R)-4-(4-acetylphenyl)-3,5,12-trioxo-7-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate.
| Compound Name | methyl 2-[(1S,2R,6R,7R)-4-(4-acetylphenyl)-3,5,12-trioxo-7-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
|---|---|
| PubChem CID | 97182726 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | methyl 2-[(1S,2R,6R,7R)-4-(4-acetylphenyl)-3,5,12-trioxo-7-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
| SMILES | COC(=O)C[C@]12C(=O)NCCN1[C@@H](c1ccccc1)[C@@H]1C(=O)N(c3ccc(C(C)=O)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H25N3O6/c1-15(30)16-8-10-18(11-9-16)29-23(32)20-21(24(29)33)26(14-19(31)35-2)25(34)27-12-13-28(26)22(20)17-6-4-3-5-7-17/h3-11,20-22H,12-14H2,1-2H3,(H,27,34)/t20-,21+,22+,26+/m1/s1 |
| InChIKey | FWEUDIBXLLHASB-QILISPFLSA-N |
| XLogP | 1.48 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|