C24H22FN3O5 — CID 30465808
methyl 2-[(1S,2R,6S,7S)-7-(4-fluorophenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate (PubChem CID 30465808) has the molecular formula C24H22FN3O5 and a molecular weight of 451.45 g/mol. Its IUPAC name is methyl 2-[(1S,2R,6S,7S)-7-(4-fluorophenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate.
| Compound Name | methyl 2-[(1S,2R,6S,7S)-7-(4-fluorophenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
|---|---|
| PubChem CID | 30465808 |
| Molecular Formula | C24H22FN3O5 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | methyl 2-[(1S,2R,6S,7S)-7-(4-fluorophenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
| SMILES | COC(=O)C[C@]12C(=O)NCCN1[C@H](c1ccc(F)cc1)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H22FN3O5/c1-33-17(29)13-24-19-18(21(30)28(22(19)31)16-5-3-2-4-6-16)20(14-7-9-15(25)10-8-14)27(24)12-11-26-23(24)32/h2-10,18-20H,11-13H2,1H3,(H,26,32)/t18-,19-,20+,24-/m0/s1 |
| InChIKey | KHUAMRHIACJIPJ-KTIHBUSBSA-N |
| XLogP | 1.42 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|