C25H25N3O5 — CID 43854034
methyl 2-[7-(4-methylphenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate (PubChem CID 43854034) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is methyl 2-[7-(4-methylphenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate.
| Compound Name | methyl 2-[7-(4-methylphenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
|---|---|
| PubChem CID | 43854034 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | methyl 2-[7-(4-methylphenyl)-3,5,12-trioxo-4-phenyl-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
| SMILES | COC(=O)CC12C(=O)NCCN1C(c1ccc(C)cc1)C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C25H25N3O5/c1-15-8-10-16(11-9-15)21-19-20(23(31)28(22(19)30)17-6-4-3-5-7-17)25(14-18(29)33-2)24(32)26-12-13-27(21)25/h3-11,19-21H,12-14H2,1-2H3,(H,26,32) |
| InChIKey | PQMKZDYILXCIJA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|