C23H23N3O7 — CID 98299624
methyl 2-[(1S,2R,6R,7S)-7-(furan-2-yl)-4-(4-methoxyphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate (PubChem CID 98299624) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is methyl 2-[(1S,2R,6R,7S)-7-(furan-2-yl)-4-(4-methoxyphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate.
| Compound Name | methyl 2-[(1S,2R,6R,7S)-7-(furan-2-yl)-4-(4-methoxyphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
|---|---|
| PubChem CID | 98299624 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl 2-[(1S,2R,6R,7S)-7-(furan-2-yl)-4-(4-methoxyphenyl)-3,5,12-trioxo-4,8,11-triazatricyclo[6.4.0.02,6]dodecan-1-yl]acetate |
| SMILES | COC(=O)C[C@]12C(=O)NCCN1[C@H](c1ccco1)[C@@H]1C(=O)N(c3ccc(OC)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C23H23N3O7/c1-31-14-7-5-13(6-8-14)26-20(28)17-18(21(26)29)23(12-16(27)32-2)22(30)24-9-10-25(23)19(17)15-4-3-11-33-15/h3-8,11,17-19H,9-10,12H2,1-2H3,(H,24,30)/t17-,18+,19-,23+/m1/s1 |
| InChIKey | IAVIOSIECRAVBW-KCESLBEFSA-N |
| XLogP | 0.88 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|