C19H25NO — CID 98086094
(1R,4S)-3,3-dimethyl-2-methylidene-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98086094) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (1R,4S)-3,3-dimethyl-2-methylidene-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,4S)-3,3-dimethyl-2-methylidene-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98086094 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (1R,4S)-3,3-dimethyl-2-methylidene-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C(C)(C)[C@H]2CC[C@@]1(C(=O)NCCc1ccccc1)C2 |
| InChI | InChI=1S/C19H25NO/c1-14-18(2,3)16-9-11-19(14,13-16)17(21)20-12-10-15-7-5-4-6-8-15/h4-8,16H,1,9-13H2,2-3H3,(H,20,21)/t16-,19+/m0/s1 |
| InChIKey | ZGPWSXZMGYKAKH-QFBILLFUSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|