C14H20 — CID 98116042
(1S,2R,6S,7S)-4,8-diethyltricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 98116042) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (1S,2R,6S,7S)-4,8-diethyltricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1S,2R,6S,7S)-4,8-diethyltricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 98116042 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (1S,2R,6S,7S)-4,8-diethyltricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | CCC1=C[C@H]2[C@H](C1)[C@@H]1C[C@@H]2C=C1CC |
| InChI | InChI=1S/C14H20/c1-3-9-5-12-11-7-10(4-2)13(8-11)14(12)6-9/h5,7,11-14H,3-4,6,8H2,1-2H3/t11-,12+,13+,14-/m0/s1 |
| InChIKey | STDXPWQTVGDGKE-DGAVXFQQSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|