C22H30O4 — CID 123601403
2-[9-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethyl 2-methylprop-2-enoate (PubChem CID 123601403) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[9-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[9-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123601403 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[9-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC1=CC2C3CC(C=C3CCOC(O)C(=C)C)C2C1 |
| InChI | InChI=1S/C22H30O4/c1-13(2)21(23)25-7-5-15-9-18-17-11-16(19(12-17)20(18)10-15)6-8-26-22(24)14(3)4/h10-11,17-20,22,24H,1,3,5-9,12H2,2,4H3 |
| InChIKey | IHLBTLRCOILTQE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|