C24H38N2O8 — CID 134238609
2-[2-[5-[[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxycarbonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]ethylcarbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 134238609) has the molecular formula C24H38N2O8 and a molecular weight of 482.57 g/mol. Its IUPAC name is 2-[2-[5-[[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxycarbonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]ethylcarbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[5-[[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxycarbonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]ethylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134238609 |
| Molecular Formula | C24H38N2O8 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 2-[2-[5-[[2-(1-hydroxy-2-methylprop-2-enoxy)ethoxycarbonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]ethylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCCC1CC2CC1CC2CNC(=O)OCCOC(O)C(=C)C |
| InChI | InChI=1S/C24H38N2O8/c1-15(2)21(27)31-7-9-33-23(29)25-6-5-17-11-19-12-18(17)13-20(19)14-26-24(30)34-10-8-32-22(28)16(3)4/h17-20,22,28H,1,3,5-14H2,2,4H3,(H,25,29)(H,26,30) |
| InChIKey | IPOACEWGMNPCBT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|