C33H46O14 — CID 157318449
4-O-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl] 1-O-(2-phenoxyethyl) butanedioate;4-O-(2-methyl-3-oxobutan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate (PubChem CID 157318449) has the molecular formula C33H46O14 and a molecular weight of 666.72 g/mol. Its IUPAC name is 4-O-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl] 1-O-(2-phenoxyethyl) butanedioate;4-O-(2-methyl-3-oxobutan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate.
| Compound Name | 4-O-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl] 1-O-(2-phenoxyethyl) butanedioate;4-O-(2-methyl-3-oxobutan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 157318449 |
| Molecular Formula | C33H46O14 |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 4-O-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl] 1-O-(2-phenoxyethyl) butanedioate;4-O-(2-methyl-3-oxobutan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)OC(C)(C)C(C)=O.C=C(C)C(O)OCCOC(=O)CCC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C18H24O7.C15H22O7/c1-14(2)18(21)25-13-12-24-17(20)9-8-16(19)23-11-10-22-15-6-4-3-5-7-15;1-10(2)14(19)21-9-8-20-12(17)6-7-13(18)22-15(4,5)11(3)16/h3-7,18,21H,1,8-13H2,2H3;1,6-9H2,2-5H3 |
| InChIKey | BDWPOEUPDCRXQT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|