C8H4O4 — CID 98116501
(1R,7R)-4,10-dioxatricyclo[5.2.1.02,6]deca-2(6),8-diene-3,5-dione (PubChem CID 98116501) has the molecular formula C8H4O4 and a molecular weight of 164.12 g/mol. Its IUPAC name is (1R,7R)-4,10-dioxatricyclo[5.2.1.02,6]deca-2(6),8-diene-3,5-dione.
| Compound Name | (1R,7R)-4,10-dioxatricyclo[5.2.1.02,6]deca-2(6),8-diene-3,5-dione |
|---|---|
| PubChem CID | 98116501 |
| Molecular Formula | C8H4O4 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | (1R,7R)-4,10-dioxatricyclo[5.2.1.02,6]deca-2(6),8-diene-3,5-dione |
| SMILES | O=C1OC(=O)C2=C1[C@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C8H4O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-4H/t3-,4-/m1/s1 |
| InChIKey | GUXFBTSMGPMSKL-QWWZWVQMSA-N |
| XLogP | -0.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|