C4H2O4 — CID 98050944
(1R,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 98050944) has the molecular formula C4H2O4 and a molecular weight of 114.06 g/mol. Its IUPAC name is (1R,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | (1R,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 98050944 |
| Molecular Formula | C4H2O4 |
| Molecular Weight | 114.06 g/mol |
| Exact Mass | 114.00 |
| IUPAC Name | (1R,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1OC(=O)[C@@H]2O[C@@H]12 |
| InChI | InChI=1S/C4H2O4/c5-3-1-2(7-1)4(6)8-3/h1-2H/t1-,2-/m1/s1 |
| InChIKey | ILABOOGTVTXVFN-JCYAYHJZSA-N |
| XLogP | -1.16 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.06 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|