C18H18ClNO4 — CID 98125857
2-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl 2-phenylacetate (PubChem CID 98125857) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl 2-phenylacetate.
| Compound Name | 2-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl 2-phenylacetate |
|---|---|
| PubChem CID | 98125857 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[(3aS,7aS)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OCCN1C(=O)[C@H]2CC=C(Cl)C[C@@H]2C1=O |
| InChI | InChI=1S/C18H18ClNO4/c19-13-6-7-14-15(11-13)18(23)20(17(14)22)8-9-24-16(21)10-12-4-2-1-3-5-12/h1-6,14-15H,7-11H2/t14-,15-/m0/s1 |
| InChIKey | XPUWFXJDOMWHCL-GJZGRUSLSA-N |
| XLogP | 2.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|