C26H30N2O2S — CID 98126422
3-[4-(acetamidomethyl)cyclohexyl]-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 98126422) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is 3-[4-(acetamidomethyl)cyclohexyl]-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[4-(acetamidomethyl)cyclohexyl]-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 98126422 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-[4-(acetamidomethyl)cyclohexyl]-N-(2-phenylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(=O)NCC1CCC(c2c(C(=O)NCCc3ccccc3)sc3ccccc23)CC1 |
| InChI | InChI=1S/C26H30N2O2S/c1-18(29)28-17-20-11-13-21(14-12-20)24-22-9-5-6-10-23(22)31-25(24)26(30)27-16-15-19-7-3-2-4-8-19/h2-10,20-21H,11-17H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | YNXCFNHREWUGMX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |