C16H28O2 — CID 98134522
(2S,6R)-4,4,6-trimethyl-2-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]-1,3-dioxane (PubChem CID 98134522) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (2S,6R)-4,4,6-trimethyl-2-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]-1,3-dioxane.
| Compound Name | (2S,6R)-4,4,6-trimethyl-2-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 98134522 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (2S,6R)-4,4,6-trimethyl-2-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]-1,3-dioxane |
| SMILES | CC1=C[C@@H](C)[C@@](C)([C@H]2O[C@H](C)CC(C)(C)O2)CC1 |
| InChI | InChI=1S/C16H28O2/c1-11-7-8-16(6,12(2)9-11)14-17-13(3)10-15(4,5)18-14/h9,12-14H,7-8,10H2,1-6H3/t12-,13-,14+,16+/m1/s1 |
| InChIKey | SCSBONVORAHFCA-NYTXWWLZSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|