C21H23FN2O3 — CID 98137880
1-[(1S,5S)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]-2-phenoxyethanone (PubChem CID 98137880) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is 1-[(1S,5S)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]-2-phenoxyethanone.
| Compound Name | 1-[(1S,5S)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 98137880 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[(1S,5S)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1C[C@@H]2CCC[C@@H](C1)C2(O)c1cccnc1F |
| InChI | InChI=1S/C21H23FN2O3/c22-20-18(10-5-11-23-20)21(26)15-6-4-7-16(21)13-24(12-15)19(25)14-27-17-8-2-1-3-9-17/h1-3,5,8-11,15-16,26H,4,6-7,12-14H2/t15-,16-/m0/s1 |
| InChIKey | XXYRTQAPLJPOLK-HOTGVXAUSA-N |
| XLogP | 2.75 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|