C17H25N3O2 — CID 98138159
2-[(5S,7S)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-adamantyl]acetohydrazide (PubChem CID 98138159) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[(5S,7S)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-adamantyl]acetohydrazide.
| Compound Name | 2-[(5S,7S)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-adamantyl]acetohydrazide |
|---|---|
| PubChem CID | 98138159 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[(5S,7S)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-adamantyl]acetohydrazide |
| SMILES | Cc1noc(C)c1C12C[C@H]3C[C@@H](CC(CC(=O)NN)(C3)C1)C2 |
| InChI | InChI=1S/C17H25N3O2/c1-10-15(11(2)22-20-10)17-6-12-3-13(7-17)5-16(4-12,9-17)8-14(21)19-18/h12-13H,3-9,18H2,1-2H3,(H,19,21)/t12-,13-,16?,17?/m0/s1 |
| InChIKey | KKRYKLXMGPICTO-SCQRFTTHSA-N |
| XLogP | 2.51 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|