C21H24N2O — CID 98156707
(NE)-N-[(1S,3S,4S)-3-(dibenzylamino)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 98156707) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (NE)-N-[(1S,3S,4S)-3-(dibenzylamino)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,3S,4S)-3-(dibenzylamino)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 98156707 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (NE)-N-[(1S,3S,4S)-3-(dibenzylamino)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | O/N=C1\[C@H]2CC[C@@H](C2)[C@@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c24-22-20-18-11-12-19(13-18)21(20)23(14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-10,18-19,21,24H,11-15H2/b22-20+/t18-,19-,21-/m0/s1 |
| InChIKey | KQJQNSLESJCQQO-PFSYMRNGSA-N |
| XLogP | 4.32 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|