C14H17N3O3 — CID 98156057
2-hydroxy-N'-[(1R,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]benzohydrazide (PubChem CID 98156057) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-hydroxy-N'-[(1R,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]benzohydrazide.
| Compound Name | 2-hydroxy-N'-[(1R,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]benzohydrazide |
|---|---|
| PubChem CID | 98156057 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-hydroxy-N'-[(1R,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]benzohydrazide |
| SMILES | O=C(NN[C@@H]1/C(=N/O)[C@H]2CC[C@@H]1C2)c1ccccc1O |
| InChI | InChI=1S/C14H17N3O3/c18-11-4-2-1-3-10(11)14(19)16-15-12-8-5-6-9(7-8)13(12)17-20/h1-4,8-9,12,15,18,20H,5-7H2,(H,16,19)/b17-13+/t8-,9+,12+/m1/s1 |
| InChIKey | IVILXDGHXDZAIT-ZTLNXOEVSA-N |
| XLogP | 1.26 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|