C20H18O3 — CID 98159910
(2S,6S,7S,12S)-4-oxapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),14,16,18,20-pentaene-3,5-dione (PubChem CID 98159910) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S,6S,7S,12S)-4-oxapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),14,16,18,20-pentaene-3,5-dione.
| Compound Name | (2S,6S,7S,12S)-4-oxapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),14,16,18,20-pentaene-3,5-dione |
|---|---|
| PubChem CID | 98159910 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2S,6S,7S,12S)-4-oxapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),14,16,18,20-pentaene-3,5-dione |
| SMILES | O=C1OC(=O)[C@@H]2c3c(ccc4ccccc34)[C@H]3CCCC[C@@H]3[C@H]12 |
| InChI | InChI=1S/C20H18O3/c21-19-17-14-8-4-3-7-13(14)15-10-9-11-5-1-2-6-12(11)16(15)18(17)20(22)23-19/h1-2,5-6,9-10,13-14,17-18H,3-4,7-8H2/t13-,14-,17-,18+/m0/s1 |
| InChIKey | GMVBBHPSZDEHRJ-DFEHZGFQSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|