C17H22Br2N2O3 — CID 98164549
(1S,2R,6R,7S,8S,9R)-8,9-dibromo-4-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98164549) has the molecular formula C17H22Br2N2O3 and a molecular weight of 462.18 g/mol. Its IUPAC name is (1S,2R,6R,7S,8S,9R)-8,9-dibromo-4-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8S,9R)-8,9-dibromo-4-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98164549 |
| Molecular Formula | C17H22Br2N2O3 |
| Molecular Weight | 462.18 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | (1S,2R,6R,7S,8S,9R)-8,9-dibromo-4-[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[C@H](C(=O)N1CCCCC1)N1C(=O)[C@H]2[C@@H]3C[C@H]([C@@H](Br)[C@H]3Br)[C@@H]2C1=O |
| InChI | InChI=1S/C17H22Br2N2O3/c1-8(15(22)20-5-3-2-4-6-20)21-16(23)11-9-7-10(12(11)17(21)24)14(19)13(9)18/h8-14H,2-7H2,1H3/t8-,9+,10+,11+,12+,13-,14+/m1/s1 |
| InChIKey | GZTZQEQSWBKTJG-VWBGDHHKSA-N |
| XLogP | 2.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|