C22H26N2O2S — CID 98186762
N-(benzenesulfonyl)-N'-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]benzenecarboximidamide (PubChem CID 98186762) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N'-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]benzenecarboximidamide.
| Compound Name | N-(benzenesulfonyl)-N'-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 98186762 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-(benzenesulfonyl)-N'-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]benzenecarboximidamide |
| SMILES | C[C@@H](/N=C(\NS(=O)(=O)c1ccccc1)c1ccccc1)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C22H26N2O2S/c1-16(21-15-17-12-13-19(21)14-17)23-22(18-8-4-2-5-9-18)24-27(25,26)20-10-6-3-7-11-20/h2-11,16-17,19,21H,12-15H2,1H3,(H,23,24)/t16-,17-,19-,21+/m1/s1 |
| InChIKey | VQRLBWJYBZGWPM-ZJSJBZJDSA-N |
| XLogP | 4.24 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|