C27H23ClN4O4S2 — CID 98201500
(2R)-2-[(4-chlorophenyl)methyl]-N,N'-bis(5-methoxy-1,3-benzothiazol-2-yl)butanediamide (PubChem CID 98201500) has the molecular formula C27H23ClN4O4S2 and a molecular weight of 567.09 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)methyl]-N,N'-bis(5-methoxy-1,3-benzothiazol-2-yl)butanediamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)methyl]-N,N'-bis(5-methoxy-1,3-benzothiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 98201500 |
| Molecular Formula | C27H23ClN4O4S2 |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)methyl]-N,N'-bis(5-methoxy-1,3-benzothiazol-2-yl)butanediamide |
| SMILES | COc1ccc2sc(NC(=O)C[C@@H](Cc3ccc(Cl)cc3)C(=O)Nc3nc4cc(OC)ccc4s3)nc2c1 |
| InChI | InChI=1S/C27H23ClN4O4S2/c1-35-18-7-9-22-20(13-18)29-26(37-22)31-24(33)12-16(11-15-3-5-17(28)6-4-15)25(34)32-27-30-21-14-19(36-2)8-10-23(21)38-27/h3-10,13-14,16H,11-12H2,1-2H3,(H,29,31,33)(H,30,32,34)/t16-/m1/s1 |
| InChIKey | DDABHYZCKAXPJX-MRXNPFEDSA-N |
| XLogP | 6.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |