C34H36ClNO6S — CID 98218746
(8-hexyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2R)-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 98218746) has the molecular formula C34H36ClNO6S and a molecular weight of 622.18 g/mol. Its IUPAC name is (8-hexyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2R)-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (8-hexyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2R)-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 98218746 |
| Molecular Formula | C34H36ClNO6S |
| Molecular Weight | 622.18 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | (8-hexyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2R)-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCCCCCc1cc2c3c(c(=O)oc2cc1OC(=O)[C@@H](Cc1ccc(Cl)cc1)NS(=O)(=O)c1ccc(C)cc1)CCC3 |
| InChI | InChI=1S/C34H36ClNO6S/c1-3-4-5-6-8-24-20-29-27-9-7-10-28(27)33(37)42-32(29)21-31(24)41-34(38)30(19-23-13-15-25(35)16-14-23)36-43(39,40)26-17-11-22(2)12-18-26/h11-18,20-21,30,36H,3-10,19H2,1-2H3/t30-/m1/s1 |
| InChIKey | JUVOZQGRAWOHFP-SSEXGKCCSA-N |
| XLogP | 6.86 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.18 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|