C27H37N3S — CID 98291133
(4R)-5-(1-adamantylimino)-3,3-dimethyl-1-phenyl-4-piperidin-1-ylpyrrolidine-2-thione (PubChem CID 98291133) has the molecular formula C27H37N3S and a molecular weight of 435.68 g/mol. Its IUPAC name is (4R)-5-(1-adamantylimino)-3,3-dimethyl-1-phenyl-4-piperidin-1-ylpyrrolidine-2-thione.
| Compound Name | (4R)-5-(1-adamantylimino)-3,3-dimethyl-1-phenyl-4-piperidin-1-ylpyrrolidine-2-thione |
|---|---|
| PubChem CID | 98291133 |
| Molecular Formula | C27H37N3S |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | (4R)-5-(1-adamantylimino)-3,3-dimethyl-1-phenyl-4-piperidin-1-ylpyrrolidine-2-thione |
| SMILES | CC1(C)C(=S)N(c2ccccc2)/C(=N\C23CC4CC(CC(C4)C2)C3)[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C27H37N3S/c1-26(2)23(29-11-7-4-8-12-29)24(30(25(26)31)22-9-5-3-6-10-22)28-27-16-19-13-20(17-27)15-21(14-19)18-27/h3,5-6,9-10,19-21,23H,4,7-8,11-18H2,1-2H3/b28-24-/t19?,20?,21?,23-,27?/m0/s1 |
| InChIKey | BFXNDGFLRBLEOC-QYYLZMECSA-N |
| XLogP | 6.08 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|