C27H34F3N3S2 — CID 98291153
(4S)-5-(1-adamantylimino)-3,3-dimethyl-4-thiomorpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione (PubChem CID 98291153) has the molecular formula C27H34F3N3S2 and a molecular weight of 521.72 g/mol. Its IUPAC name is (4S)-5-(1-adamantylimino)-3,3-dimethyl-4-thiomorpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione.
| Compound Name | (4S)-5-(1-adamantylimino)-3,3-dimethyl-4-thiomorpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 98291153 |
| Molecular Formula | C27H34F3N3S2 |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | (4S)-5-(1-adamantylimino)-3,3-dimethyl-4-thiomorpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
| SMILES | CC1(C)C(=S)N(c2cccc(C(F)(F)F)c2)/C(=N/C23CC4CC(CC(C4)C2)C3)[C@H]1N1CCSCC1 |
| InChI | InChI=1S/C27H34F3N3S2/c1-25(2)22(32-6-8-35-9-7-32)23(31-26-14-17-10-18(15-26)12-19(11-17)16-26)33(24(25)34)21-5-3-4-20(13-21)27(28,29)30/h3-5,13,17-19,22H,6-12,14-16H2,1-2H3/b31-23+/t17?,18?,19?,22-,26?/m1/s1 |
| InChIKey | ZXKSKPYXOAIOSL-GGYXDGTHSA-N |
| XLogP | 6.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|