C30H36F3N3S — CID 92501691
(4S)-4-piperidin-1-yl-2-[3-(trifluoromethyl)phenyl]-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decane-1-thione (PubChem CID 92501691) has the molecular formula C30H36F3N3S and a molecular weight of 527.70 g/mol. Its IUPAC name is (4S)-4-piperidin-1-yl-2-[3-(trifluoromethyl)phenyl]-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decane-1-thione.
| Compound Name | (4S)-4-piperidin-1-yl-2-[3-(trifluoromethyl)phenyl]-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decane-1-thione |
|---|---|
| PubChem CID | 92501691 |
| Molecular Formula | C30H36F3N3S |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | (4S)-4-piperidin-1-yl-2-[3-(trifluoromethyl)phenyl]-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decane-1-thione |
| SMILES | Cc1cc(C)c(/N=C2\[C@@H](N3CCCCC3)C3(CCCCC3)C(=S)N2c2cccc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C30H36F3N3S/c1-20-17-21(2)25(22(3)18-20)34-27-26(35-15-8-5-9-16-35)29(13-6-4-7-14-29)28(37)36(27)24-12-10-11-23(19-24)30(31,32)33/h10-12,17-19,26H,4-9,13-16H2,1-3H3/b34-27+/t26-/m1/s1 |
| InChIKey | ROEANYSMJLBQAO-USBPOQAUSA-N |
| XLogP | 8.31 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|