C23H23ClF3N3OS — CID 46289281
5-(4-chlorophenyl)imino-3,3-dimethyl-4-morpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione (PubChem CID 46289281) has the molecular formula C23H23ClF3N3OS and a molecular weight of 481.97 g/mol. Its IUPAC name is 5-(4-chlorophenyl)imino-3,3-dimethyl-4-morpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione.
| Compound Name | 5-(4-chlorophenyl)imino-3,3-dimethyl-4-morpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 46289281 |
| Molecular Formula | C23H23ClF3N3OS |
| Molecular Weight | 481.97 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 5-(4-chlorophenyl)imino-3,3-dimethyl-4-morpholin-4-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
| SMILES | CC1(C)C(=S)N(c2cccc(C(F)(F)F)c2)/C(=N/c2ccc(Cl)cc2)C1N1CCOCC1 |
| InChI | InChI=1S/C23H23ClF3N3OS/c1-22(2)19(29-10-12-31-13-11-29)20(28-17-8-6-16(24)7-9-17)30(21(22)32)18-5-3-4-15(14-18)23(25,26)27/h3-9,14,19H,10-13H2,1-2H3/b28-20+ |
| InChIKey | YHWJLVDXSJWGSF-VFCFBJKWSA-N |
| XLogP | 5.96 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|