C28H36F3N3S — CID 92501627
(4R)-5-(1-adamantylimino)-3,3-dimethyl-4-piperidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione (PubChem CID 92501627) has the molecular formula C28H36F3N3S and a molecular weight of 503.68 g/mol. Its IUPAC name is (4R)-5-(1-adamantylimino)-3,3-dimethyl-4-piperidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione.
| Compound Name | (4R)-5-(1-adamantylimino)-3,3-dimethyl-4-piperidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 92501627 |
| Molecular Formula | C28H36F3N3S |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | (4R)-5-(1-adamantylimino)-3,3-dimethyl-4-piperidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
| SMILES | CC1(C)C(=S)N(c2cccc(C(F)(F)F)c2)/C(=N/C23CC4CC(CC(C4)C2)C3)[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C28H36F3N3S/c1-26(2)23(33-9-4-3-5-10-33)24(32-27-15-18-11-19(16-27)13-20(12-18)17-27)34(25(26)35)22-8-6-7-21(14-22)28(29,30)31/h6-8,14,18-20,23H,3-5,9-13,15-17H2,1-2H3/b32-24+/t18?,19?,20?,23-,27?/m0/s1 |
| InChIKey | ITUFTNDCJGEIMD-DHLMGKHISA-N |
| XLogP | 7.10 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|