C28H37F3N4S — CID 46289301
5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione (PubChem CID 46289301) has the molecular formula C28H37F3N4S and a molecular weight of 518.69 g/mol. Its IUPAC name is 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione.
| Compound Name | 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 46289301 |
| Molecular Formula | C28H37F3N4S |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2-thione |
| SMILES | CN1CCN(C2/C(=N\C34CC5CC(CC(C5)C3)C4)N(c3cccc(C(F)(F)F)c3)C(=S)C2(C)C)CC1 |
| InChI | InChI=1S/C28H37F3N4S/c1-26(2)23(34-9-7-33(3)8-10-34)24(32-27-15-18-11-19(16-27)13-20(12-18)17-27)35(25(26)36)22-6-4-5-21(14-22)28(29,30)31/h4-6,14,18-20,23H,7-13,15-17H2,1-3H3/b32-24+ |
| InChIKey | NDLGZQOUHSGIGJ-FEZSWGLMSA-N |
| XLogP | 5.86 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|