C20H23Cl2N3O2S — CID 983123
1-[2-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,5-dichloro-4-pyridinyl)thiourea (PubChem CID 983123) has the molecular formula C20H23Cl2N3O2S and a molecular weight of 440.40 g/mol. Its IUPAC name is 1-[2-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,5-dichloro-4-pyridinyl)thiourea.
| Compound Name | 1-[2-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,5-dichloro-4-pyridinyl)thiourea |
|---|---|
| PubChem CID | 983123 |
| Molecular Formula | C20H23Cl2N3O2S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 1-[2-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,5-dichloro-4-pyridinyl)thiourea |
| SMILES | COc1cc(CCNC(=S)Nc2c(Cl)cncc2Cl)ccc1OC1CCCC1 |
| InChI | InChI=1S/C20H23Cl2N3O2S/c1-26-18-10-13(6-7-17(18)27-14-4-2-3-5-14)8-9-24-20(28)25-19-15(21)11-23-12-16(19)22/h6-7,10-12,14H,2-5,8-9H2,1H3,(H2,23,24,25,28) |
| InChIKey | HQEOUNIFEXTGIL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|