C28H23F3N2O5 — CID 98389025
ethyl (3S)-1-[1,3-dioxo-2-[3-(trifluoromethyl)phenyl]benzo[de]isoquinoline-6-carbonyl]piperidine-3-carboxylate (PubChem CID 98389025) has the molecular formula C28H23F3N2O5 and a molecular weight of 524.50 g/mol. Its IUPAC name is ethyl (3S)-1-[1,3-dioxo-2-[3-(trifluoromethyl)phenyl]benzo[de]isoquinoline-6-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[1,3-dioxo-2-[3-(trifluoromethyl)phenyl]benzo[de]isoquinoline-6-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98389025 |
| Molecular Formula | C28H23F3N2O5 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | ethyl (3S)-1-[1,3-dioxo-2-[3-(trifluoromethyl)phenyl]benzo[de]isoquinoline-6-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2ccc3c4c(cccc24)C(=O)N(c2cccc(C(F)(F)F)c2)C3=O)C1 |
| InChI | InChI=1S/C28H23F3N2O5/c1-2-38-27(37)16-6-5-13-32(15-16)24(34)20-11-12-22-23-19(20)9-4-10-21(23)25(35)33(26(22)36)18-8-3-7-17(14-18)28(29,30)31/h3-4,7-12,14,16H,2,5-6,13,15H2,1H3/t16-/m0/s1 |
| InChIKey | REPAYDODEXEMPT-INIZCTEOSA-N |
| XLogP | 5.07 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|