C26H28FN8O4P — CID 98389364
3-[(1S)-3-(2-fluorophenyl)-1-(2-methoxy-5-nitrophenyl)imino-2,7-dimethyl-1-morpholin-4-ylpyrazolo[4,5-c][1,5,2]diazaphosphinin-5-yl]propanenitrile (PubChem CID 98389364) has the molecular formula C26H28FN8O4P and a molecular weight of 566.53 g/mol. Its IUPAC name is 3-[(1S)-3-(2-fluorophenyl)-1-(2-methoxy-5-nitrophenyl)imino-2,7-dimethyl-1-morpholin-4-ylpyrazolo[4,5-c][1,5,2]diazaphosphinin-5-yl]propanenitrile.
| Compound Name | 3-[(1S)-3-(2-fluorophenyl)-1-(2-methoxy-5-nitrophenyl)imino-2,7-dimethyl-1-morpholin-4-ylpyrazolo[4,5-c][1,5,2]diazaphosphinin-5-yl]propanenitrile |
|---|---|
| PubChem CID | 98389364 |
| Molecular Formula | C26H28FN8O4P |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 3-[(1S)-3-(2-fluorophenyl)-1-(2-methoxy-5-nitrophenyl)imino-2,7-dimethyl-1-morpholin-4-ylpyrazolo[4,5-c][1,5,2]diazaphosphinin-5-yl]propanenitrile |
| SMILES | COc1ccc([N+](=O)[O-])cc1N=[P@]1(N2CCOCC2)c2c(C)nn(CCC#N)c2N=C(c2ccccc2F)N1C |
| InChI | InChI=1S/C26H28FN8O4P/c1-18-24-26(34(30-18)12-6-11-28)29-25(20-7-4-5-8-21(20)27)32(2)40(24,33-13-15-39-16-14-33)31-22-17-19(35(36)37)9-10-23(22)38-3/h4-5,7-10,17H,6,12-16H2,1-3H3/t40-/m1/s1 |
| InChIKey | DLGSZAKXWYAGQS-RRHRGVEJSA-N |
| XLogP | 4.51 |
| TPSA | 134.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|