C23H29N4O7P — CID 5069797
2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxy-5-nitrophenyl)imino-dimorpholin-4-yl-λ5-phosphane (PubChem CID 5069797) has the molecular formula C23H29N4O7P and a molecular weight of 504.48 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxy-5-nitrophenyl)imino-dimorpholin-4-yl-λ5-phosphane.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxy-5-nitrophenyl)imino-dimorpholin-4-yl-λ5-phosphane |
|---|---|
| PubChem CID | 5069797 |
| Molecular Formula | C23H29N4O7P |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxy-5-nitrophenyl)imino-dimorpholin-4-yl-λ5-phosphane |
| SMILES | COc1ccc([N+](=O)[O-])cc1N=P(c1ccc2c(c1)OCCO2)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C23H29N4O7P/c1-30-21-4-2-18(27(28)29)16-20(21)24-35(25-6-10-31-11-7-25,26-8-12-32-13-9-26)19-3-5-22-23(17-19)34-15-14-33-22/h2-5,16-17H,6-15H2,1H3 |
| InChIKey | ADXTWIDEEQGDCO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|