C11H12F4O2S — CID 98394053
methyl (1S,2R,6S,7S,8R)-4,4,5,5-tetrafluoro-3-thiatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 98394053) has the molecular formula C11H12F4O2S and a molecular weight of 284.27 g/mol. Its IUPAC name is methyl (1S,2R,6S,7S,8R)-4,4,5,5-tetrafluoro-3-thiatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | methyl (1S,2R,6S,7S,8R)-4,4,5,5-tetrafluoro-3-thiatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 98394053 |
| Molecular Formula | C11H12F4O2S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | methyl (1S,2R,6S,7S,8R)-4,4,5,5-tetrafluoro-3-thiatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2C[C@@H]1[C@@H]1[C@@H]2SC(F)(F)C1(F)F |
| InChI | InChI=1S/C11H12F4O2S/c1-17-9(16)6-3-4-2-5(6)7-8(4)18-11(14,15)10(7,12)13/h4-8H,2-3H2,1H3/t4-,5-,6+,7+,8+/m0/s1 |
| InChIKey | HCPVBBPSFIHYAT-TVNFTVLESA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|