C26H21Cl2N5O3 — CID 98414723
1-[4-[(3aS)-5-benzoyl-3-oxo-3a,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-yl]phenyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 98414723) has the molecular formula C26H21Cl2N5O3 and a molecular weight of 522.39 g/mol. Its IUPAC name is 1-[4-[(3aS)-5-benzoyl-3-oxo-3a,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-yl]phenyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[4-[(3aS)-5-benzoyl-3-oxo-3a,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-yl]phenyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 98414723 |
| Molecular Formula | C26H21Cl2N5O3 |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 1-[4-[(3aS)-5-benzoyl-3-oxo-3a,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-yl]phenyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(N2N=C3CCN(C(=O)c4ccccc4)C[C@@H]3C2=O)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H21Cl2N5O3/c27-21-11-8-18(14-22(21)28)30-26(36)29-17-6-9-19(10-7-17)33-25(35)20-15-32(13-12-23(20)31-33)24(34)16-4-2-1-3-5-16/h1-11,14,20H,12-13,15H2,(H2,29,30,36)/t20-/m0/s1 |
| InChIKey | PVLAUVGDKJTBSU-FQEVSTJZSA-N |
| XLogP | 5.50 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |