C16H16F2N2O2S — CID 98431547
(2S)-2-cyano-3-cyclopentyl-N-[4-(difluoromethylsulfanyl)phenyl]-3-oxopropanamide (PubChem CID 98431547) has the molecular formula C16H16F2N2O2S and a molecular weight of 338.38 g/mol. Its IUPAC name is (2S)-2-cyano-3-cyclopentyl-N-[4-(difluoromethylsulfanyl)phenyl]-3-oxopropanamide.
| Compound Name | (2S)-2-cyano-3-cyclopentyl-N-[4-(difluoromethylsulfanyl)phenyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 98431547 |
| Molecular Formula | C16H16F2N2O2S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2S)-2-cyano-3-cyclopentyl-N-[4-(difluoromethylsulfanyl)phenyl]-3-oxopropanamide |
| SMILES | N#C[C@H](C(=O)Nc1ccc(SC(F)F)cc1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C16H16F2N2O2S/c17-16(18)23-12-7-5-11(6-8-12)20-15(22)13(9-19)14(21)10-3-1-2-4-10/h5-8,10,13,16H,1-4H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | QXPJWKURJOQULX-ZDUSSCGKSA-N |
| XLogP | 3.84 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|