C21H22Cl3N3 — CID 98505185
N-[3-[(1S)-1-[bis(2-chloroethyl)amino]ethyl]phenyl]-7-chloroquinolin-4-amine (PubChem CID 98505185) has the molecular formula C21H22Cl3N3 and a molecular weight of 422.79 g/mol. Its IUPAC name is N-[3-[(1S)-1-[bis(2-chloroethyl)amino]ethyl]phenyl]-7-chloroquinolin-4-amine.
| Compound Name | N-[3-[(1S)-1-[bis(2-chloroethyl)amino]ethyl]phenyl]-7-chloroquinolin-4-amine |
|---|---|
| PubChem CID | 98505185 |
| Molecular Formula | C21H22Cl3N3 |
| Molecular Weight | 422.79 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[3-[(1S)-1-[bis(2-chloroethyl)amino]ethyl]phenyl]-7-chloroquinolin-4-amine |
| SMILES | C[C@@H](c1cccc(Nc2ccnc3cc(Cl)ccc23)c1)N(CCCl)CCCl |
| InChI | InChI=1S/C21H22Cl3N3/c1-15(27(11-8-22)12-9-23)16-3-2-4-18(13-16)26-20-7-10-25-21-14-17(24)5-6-19(20)21/h2-7,10,13-15H,8-9,11-12H2,1H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | BRIBHQPOKSGFIR-HNNXBMFYSA-N |
| XLogP | 6.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.79 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|